CAS 438218-98-5 appears in our catalog under these names: 4-(4-Ethylphenyl)-5-methyl-1,3-thiazol-2-amine, 95%, 4-(4-Ethylphenyl)-5-methylthiazol-2-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-(4-ethylphenyl)-5-methyl-1,3-thiazol-2-amine (CAS 438218-98-5) is a chemical compound with the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. IUPAC name: 4-(4-ethylphenyl)-5-methyl-1,3-thiazol-2-amine. InChIKey: DXJYDMVDEAVIJL-UHFFFAOYSA-N.
| Molecular formula | C12H14N2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | 4-(4-ethylphenyl)-5-methyl-1,3-thiazol-2-amine |
| InChIKey | DXJYDMVDEAVIJL-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=C(SC(=N2)N)C |
Computed by PubChem (NCBI)