CAS 438227-56-6 is the registry number for 4-(2,4-Dimethylphenyl)-5-methyl-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
4-(2,4-dimethylphenyl)-5-methyl-1,3-thiazol-2-amine (CAS 438227-56-6) is a chemical compound with the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. IUPAC name: 4-(2,4-dimethylphenyl)-5-methyl-1,3-thiazol-2-amine. InChIKey: AZBAQHIVVLQMFX-UHFFFAOYSA-N.
| Molecular formula | C12H14N2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | 4-(2,4-dimethylphenyl)-5-methyl-1,3-thiazol-2-amine |
| InChIKey | AZBAQHIVVLQMFX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=C(SC(=N2)N)C)C |
Computed by PubChem (NCBI)