CAS 893724-08-8 is the registry number for 5-(3,4-dimethylbenzyl)thiazol-2-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
5-[(3,4-dimethylphenyl)methyl]-1,3-thiazol-2-amine (CAS 893724-08-8) is a chemical compound with the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. IUPAC name: 5-[(3,4-dimethylphenyl)methyl]-1,3-thiazol-2-amine. InChIKey: KISOHOLEJPVTJI-UHFFFAOYSA-N.
| Molecular formula | C12H14N2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | 5-[(3,4-dimethylphenyl)methyl]-1,3-thiazol-2-amine |
| InChIKey | KISOHOLEJPVTJI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CC2=CN=C(S2)N)C |
Computed by PubChem (NCBI)