cas: 43115-40-8 — see every product listed under this CAS number, including other names
2-Amino-4-(ethylsulfonyl)phenol 95% (CAS 43115-40-8) is a chemical reagent available from Chemat. Available pack sizes: 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A522347-100g |
| cas | 43115-40-8 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 2895.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A522347 |
2-amino-4-ethylsulfonylphenol (CAS 43115-40-8) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: 2-amino-4-ethylsulfonylphenol. InChIKey: UPJVUFCLBYQKFH-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 2-amino-4-ethylsulfonylphenol |
| InChIKey | UPJVUFCLBYQKFH-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC(=C(C=C1)O)N |
Computed by PubChem (NCBI)