CAS 43115-40-8 appears in our catalog under these names: 2-Amino-4-(ethylsulfonyl)phenol, 95%, 2-Amino-4-(ethylsulfonyl)phenol 95%, 2-Amino-4-(ethylsulfonyl)phenol, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 100g, 10g, 25g, 1g, 5g, 250mg.
2-amino-4-ethylsulfonylphenol (CAS 43115-40-8) is a chemical compound with the molecular formula C8H11NO3S and a molecular weight of 201.25 g/mol. IUPAC name: 2-amino-4-ethylsulfonylphenol. InChIKey: UPJVUFCLBYQKFH-UHFFFAOYSA-N.
| Molecular formula | C8H11NO3S |
|---|---|
| Molecular weight | 201.25 g/mol |
| IUPAC name | 2-amino-4-ethylsulfonylphenol |
| InChIKey | UPJVUFCLBYQKFH-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC(=C(C=C1)O)N |
Computed by PubChem (NCBI)