cas: 129833-29-0 — see every product listed under this CAS number, including other names
2-Amino-4-bromo-3-methylbenzoic acid, 97%, 97% (CAS 129833-29-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111TQJ-100mg |
| cas | 129833-29-0 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 323.60 Pln | |
| Chemat | 10g | 544.40 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 50g | 1922.00 Pln | |
| Chemat | 100g | 3371.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-4-bromo-3-methylbenzoic acid (CAS 129833-29-0) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 2-amino-4-bromo-3-methylbenzoic acid. InChIKey: HTSCYFVXSZXFFV-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2-amino-4-bromo-3-methylbenzoic acid |
| InChIKey | HTSCYFVXSZXFFV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1N)C(=O)O)Br |
Computed by PubChem (NCBI)