Products 129833-29-0
CAS 129833-29-0 appears in our catalog under these names: 2-amino-4-bromo-3-methylbenzoic acid, 2-Amino-4-bromo-3-methylbenzoic acid, 97%, 97%, 2-Amino-4-bromo-3-methylbenzoic acid, 97%, 2-Amino-4-bromo-3-methylbenzoic acid, 95%. Offered by: Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 100mg, 250mg, 5g, 25g, 50g, 100g.
2-amino-4-bromo-3-methylbenzoic acid (CAS 129833-29-0) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 2-amino-4-bromo-3-methylbenzoic acid. InChIKey: HTSCYFVXSZXFFV-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 2-amino-4-bromo-3-methylbenzoic acid |
| InChIKey | HTSCYFVXSZXFFV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1N)C(=O)O)Br |
Computed by PubChem (NCBI)