cas: 549488-77-9 — see every product listed under this CAS number, including other names
2-Amino-5-(trifluoromethoxy)benzonitrile 97% (CAS 549488-77-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A194621-1g |
| cas | 549488-77-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 387.06 Pln | |
| Ambeed | 10g | 704.12 Pln | |
| Ambeed | 25g | 1566.31 Pln | |
| Ambeed | 100g | 4570.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A194621 |
2-amino-5-(trifluoromethoxy)benzonitrile (CAS 549488-77-9) is a chemical compound with the molecular formula C8H5F3N2O and a molecular weight of 202.13 g/mol. IUPAC name: 2-amino-5-(trifluoromethoxy)benzonitrile. InChIKey: IEAPDKSDIISMDE-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 2-amino-5-(trifluoromethoxy)benzonitrile |
| InChIKey | IEAPDKSDIISMDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)C#N)N |
Computed by PubChem (NCBI)