cas: 72436-99-8 — see every product listed under this CAS number, including other names
2-Amino-5-Methyl-(1,2,4)triazolo(1,5-a)pyrimidin-7(4H)-one, 98+% (CAS 72436-99-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A968218-100mg |
| cas | 72436-99-8 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 799.12 Pln | |
| AmBeed | 10g | 11045.86 Pln | |
| AmBeed | 5g | 7465.36 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 72436-99-8) is a chemical compound with the molecular formula C6H7N5O and a molecular weight of 165.15 g/mol. IUPAC name: 2-amino-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: PQJWDADCCRTLQZ-UHFFFAOYSA-N.
| Molecular formula | C6H7N5O |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2-amino-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | PQJWDADCCRTLQZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=N1)N=C(N2)N |
Computed by PubChem (NCBI)