CAS 99347-08-7 appears in our catalog under these names: 5-Amino-1-methyl-1h,4h,5h-pyrazolo[3,4-d]pyrimidin-4-one, 95%, 5-Amino-1-methyl-1,5-dihydro-4H-pyrazolo(3,4-d)pyrimidin-4-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one (CAS 99347-08-7) is a chemical compound with the molecular formula C6H7N5O and a molecular weight of 165.15 g/mol. IUPAC name: 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one. InChIKey: TVKDNILWGVYQAU-UHFFFAOYSA-N.
| Molecular formula | C6H7N5O |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | TVKDNILWGVYQAU-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=O)N(C=N2)N |
Computed by PubChem (NCBI)