CAS 72436-99-8 appears in our catalog under these names: 2-Amino-5-methyl-4h-[1,2,4]triazolo[1,5-a]-pyrimidin-7-one, 95%, 2-Amino-5-Methyl-(1,2,4)triazolo(1,5-a)pyrimidin-7(4H)-one, 98+%, 2-Amino-5-methyl-4H-(1,2,4)triazolo(1,5-a)-pyrimidin-7-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 10g, 5g, 0,5g, 0,25g, 2g.
2-amino-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 72436-99-8) is a chemical compound with the molecular formula C6H7N5O and a molecular weight of 165.15 g/mol. IUPAC name: 2-amino-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: PQJWDADCCRTLQZ-UHFFFAOYSA-N.
| Molecular formula | C6H7N5O |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2-amino-5-methyl-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | PQJWDADCCRTLQZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=N1)N=C(N2)N |
Computed by PubChem (NCBI)