CAS 54099-74-0 is the registry number for 2-Amino-1,5-dihydropteridin-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
2-amino-5,8-dihydro-3H-pteridin-4-one (CAS 54099-74-0) is a chemical compound with the molecular formula C6H7N5O and a molecular weight of 165.15 g/mol. IUPAC name: 2-amino-5,8-dihydro-3H-pteridin-4-one. InChIKey: UIHSXOMREQLGFW-UHFFFAOYSA-N.
| Molecular formula | C6H7N5O |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 2-amino-5,8-dihydro-3H-pteridin-4-one |
| InChIKey | UIHSXOMREQLGFW-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C(N1)C(=O)NC(=N2)N |
Computed by PubChem (NCBI)