cas: 58026-21-4 — see every product listed under this CAS number, including other names
2-Amino-5-bromo-3-chlorobenzoic acid 97% (CAS 58026-21-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A111358-1g |
| cas | 58026-21-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1538.50 Pln | |
| Ambeed | 10g | 2584.25 Pln | |
| Ambeed | 25g | 5098.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A111358 |
2-amino-5-bromo-3-chlorobenzoic acid (CAS 58026-21-4) is a chemical compound with the molecular formula C7H5BrClNO2 and a molecular weight of 250.48 g/mol. IUPAC name: 2-amino-5-bromo-3-chlorobenzoic acid. InChIKey: WYPQWEYJRBPSKL-UHFFFAOYSA-N.
| Molecular formula | C7H5BrClNO2 |
|---|---|
| Molecular weight | 250.48 g/mol |
| IUPAC name | 2-amino-5-bromo-3-chlorobenzoic acid |
| InChIKey | WYPQWEYJRBPSKL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)Cl)Br |
Computed by PubChem (NCBI)