cas: 3073-77-6 — see every product listed under this CAS number, including other names
2-Amino-5-nitropyrimidine 97% (CAS 3073-77-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A149181-250mg |
| cas | 3073-77-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 142.31 Pln | |
| Ambeed | 5g | 159.00 Pln | |
| Ambeed | 10g | 242.44 Pln | |
| Ambeed | 25g | 431.56 Pln | |
| Ambeed | 100g | 1393.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A149181 |
5-nitropyrimidin-2-amine (CAS 3073-77-6) is a chemical compound with the molecular formula C4H4N4O2 and a molecular weight of 140.10 g/mol. IUPAC name: 5-nitropyrimidin-2-amine. InChIKey: SSHFCFRJYJIJDV-UHFFFAOYSA-N.
| Molecular formula | C4H4N4O2 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 5-nitropyrimidin-2-amine |
| InChIKey | SSHFCFRJYJIJDV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=N1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)