cas: 791626-58-9 — see every product listed under this CAS number, including other names
2-Amino-6-bromoquinoline, 98% (CAS 791626-58-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F079591-250MG |
| cas | 791626-58-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 763.29 Pln | |
| Fluorochem | 10g | 1476.58 Pln | |
| Fluorochem | 25g | 3606.04 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-bromoquinolin-2-amine (CAS 791626-58-9) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 6-bromoquinolin-2-amine. InChIKey: GSKICCPQEZRQEC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 6-bromoquinolin-2-amine |
| InChIKey | GSKICCPQEZRQEC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)N)C=C1Br |
Computed by PubChem (NCBI)