cas: 791626-58-9 — see every product listed under this CAS number, including other names
6-Bromoquinolin-2-amine, 98%, 98% (CAS 791626-58-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116AV8-100mg |
| cas | 791626-58-9 |
| size | 100mg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1509.20 Pln | |
| Chemat | 100g | 3990.80 Pln | |
| Chemat | 250g | 5589.20 Pln | |
| Chemat | 500g | 10089.60 Pln | |
| Chemat | 1kg | 18635.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-bromoquinolin-2-amine (CAS 791626-58-9) is a chemical compound with the molecular formula C9H7BrN2 and a molecular weight of 223.07 g/mol. IUPAC name: 6-bromoquinolin-2-amine. InChIKey: GSKICCPQEZRQEC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2 |
|---|---|
| Molecular weight | 223.07 g/mol |
| IUPAC name | 6-bromoquinolin-2-amine |
| InChIKey | GSKICCPQEZRQEC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=N2)N)C=C1Br |
Computed by PubChem (NCBI)