cas: 6358-09-4 — see every product listed under this CAS number, including other names
2-Amino-6-chloro-4-nitrophenol, 97%, 97% (CAS 6358-09-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 10g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114B75-25g |
| cas | 6358-09-4 |
| size | 25g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 170.00 Pln | |
| Chemat | 500g | 432.00 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 1kg | 779.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-6-chloro-4-nitrophenol (CAS 6358-09-4) is a chemical compound with the molecular formula C6H5ClN2O3 and a molecular weight of 188.57 g/mol. IUPAC name: 2-amino-6-chloro-4-nitrophenol. InChIKey: TWLMSPNQBKSXOP-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O3 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 2-amino-6-chloro-4-nitrophenol |
| InChIKey | TWLMSPNQBKSXOP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)