cas: 6358-09-4 — see every product listed under this CAS number, including other names
2-Amino-6-chloro-4-nitrophenol, 97% (CAS 6358-09-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210051-10G |
| cas | 6358-09-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 91.65 Pln | |
| Fluorochem | 100g | 190.58 Pln | |
| Fluorochem | 500g | 450.90 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-amino-6-chloro-4-nitrophenol (CAS 6358-09-4) is a chemical compound with the molecular formula C6H5ClN2O3 and a molecular weight of 188.57 g/mol. IUPAC name: 2-amino-6-chloro-4-nitrophenol. InChIKey: TWLMSPNQBKSXOP-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O3 |
|---|---|
| Molecular weight | 188.57 g/mol |
| IUPAC name | 2-amino-6-chloro-4-nitrophenol |
| InChIKey | TWLMSPNQBKSXOP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)