cas: 119004-72-7 — see every product listed under this CAS number, including other names
2-Amino-6-phenyl-4,5,6,7-tetrahydrobenzo[b]-thiophene-3-carboxylic acid methyl ester, 95% (CAS 119004-72-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014020-50MG |
| cas | 119004-72-7 |
| size | 50mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 372.80 Pln | |
| Fluorochem | 100mg | 398.84 Pln | |
| Fluorochem | 250mg | 607.10 Pln | |
| Fluorochem | 500mg | 961.14 Pln | |
| Fluorochem | 1g | 1138.16 Pln | |
| Fluorochem | 2.5g | 2049.30 Pln | |
| Fluorochem | 5g | 2611.60 Pln | |
| Fluorochem | 10g | 3855.95 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
Methyl 2-amino-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (CAS 119004-72-7) is a chemical compound with the molecular formula C16H17NO2S and a molecular weight of 287.4 g/mol. IUPAC name: methyl 2-amino-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate. InChIKey: BVXJDKFMMQTUGI-UHFFFAOYSA-N.
| Molecular formula | C16H17NO2S |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | methyl 2-amino-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| InChIKey | BVXJDKFMMQTUGI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(SC2=C1CCC(C2)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)