CAS 895933-27-4 appears in our catalog under these names: N-(4-Acetylphenyl)-4-ethyl-5-methylthiophene-3-carboxamide, 95%, N-(4-Acetylphenyl)-4-ethyl-5-methylthiophene-3-carboxamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
N-(4-acetylphenyl)-4-ethyl-5-methylthiophene-3-carboxamide (CAS 895933-27-4) is a chemical compound with the molecular formula C16H17NO2S and a molecular weight of 287.4 g/mol. IUPAC name: N-(4-acetylphenyl)-4-ethyl-5-methylthiophene-3-carboxamide. InChIKey: SUKWXOCKHYWPTE-UHFFFAOYSA-N.
| Molecular formula | C16H17NO2S |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | N-(4-acetylphenyl)-4-ethyl-5-methylthiophene-3-carboxamide |
| InChIKey | SUKWXOCKHYWPTE-UHFFFAOYSA-N |
| SMILES | CCC1=C(SC=C1C(=O)NC2=CC=C(C=C2)C(=O)C)C |
Computed by PubChem (NCBI)