CAS 5191-80-0 appears in our catalog under these names: H-Cys(dpm)-oh, 95%, H–Cys(Dpm)–Oh, (R)-2-Amino-3-(benzhydrylthio)propanoic acid, 98%, 98%, H-Cys(Dpm)-OH, 99%. Offered by: Combi-blocks, GLPBio, Chemat, Ambeed. Available pack sizes: 1g, 250mg, 50mg, 100mg, 5g.
(2R)-2-amino-3-benzhydrylsulfanylpropanoic acid (CAS 5191-80-0) is a chemical compound with the molecular formula C16H17NO2S and a molecular weight of 287.4 g/mol. IUPAC name: (2R)-2-amino-3-benzhydrylsulfanylpropanoic acid. InChIKey: SHOGZCIBPYFZRP-AWEZNQCLSA-N.
| Molecular formula | C16H17NO2S |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | (2R)-2-amino-3-benzhydrylsulfanylpropanoic acid |
| InChIKey | SHOGZCIBPYFZRP-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)SC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)