CAS 106745-67-9 is the registry number for 4-Methyl-N-(2-(prop-1-en-2-yl)phenyl)benzenesulfonamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
4-methyl-N-(2-prop-1-en-2-ylphenyl)benzenesulfonamide (CAS 106745-67-9) is a chemical compound with the molecular formula C16H17NO2S and a molecular weight of 287.4 g/mol. IUPAC name: 4-methyl-N-(2-prop-1-en-2-ylphenyl)benzenesulfonamide. InChIKey: IRMYOXJOXGIBBC-UHFFFAOYSA-N.
| Molecular formula | C16H17NO2S |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | 4-methyl-N-(2-prop-1-en-2-ylphenyl)benzenesulfonamide |
| InChIKey | IRMYOXJOXGIBBC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=C)C |
Computed by PubChem (NCBI)