cas: 213192-26-8 — see every product listed under this CAS number, including other names
2-Amino-6-tert-butyl-4,5,6,7-tetrahydrobenzo[b]-thiophene-3-carboxylic acid methyl ester (CAS 213192-26-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014017-100MG |
| cas | 213192-26-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 500mg | 164.54 Pln | |
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 2.5g | 612.30 Pln | |
| Fluorochem | 5g | 945.52 Pln | |
| Fluorochem | 10g | 1112.13 Pln |
| delivery time | 2-3 weeks |
|---|
Methyl 2-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (CAS 213192-26-8) is a chemical compound with the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. IUPAC name: methyl 2-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate. InChIKey: BYFPSGIBNPFZOY-UHFFFAOYSA-N.
| Molecular formula | C14H21NO2S |
|---|---|
| Molecular weight | 267.39 g/mol |
| IUPAC name | methyl 2-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| InChIKey | BYFPSGIBNPFZOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2=C(C1)SC(=C2C(=O)OC)N |
Computed by PubChem (NCBI)