CAS 749920-50-1 is the registry number for Methyl 3-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
Methyl 3-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (CAS 749920-50-1) is a chemical compound with the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. IUPAC name: methyl 3-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate. InChIKey: BIPFQDJTLXZSBS-UHFFFAOYSA-N.
| Molecular formula | C14H21NO2S |
|---|---|
| Molecular weight | 267.39 g/mol |
| IUPAC name | methyl 3-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| InChIKey | BIPFQDJTLXZSBS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2=C(C1)SC(=C2N)C(=O)OC |
Computed by PubChem (NCBI)