CAS 141437-85-6 appears in our catalog under these names: (S)-2-Benzyl-2-n-bocamino-ethyl thiol, 95%, (S)-tert-Butyl (1-mercapto-3-phenylpropan-2-yl)carbamate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g.
Tert-butyl N-[(2S)-1-phenyl-3-sulfanylpropan-2-yl]carbamate (CAS 141437-85-6) is a chemical compound with the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. IUPAC name: tert-butyl N-[(2S)-1-phenyl-3-sulfanylpropan-2-yl]carbamate. InChIKey: PYBYEBRVJRDWPB-LBPRGKRZSA-N.
| Molecular formula | C14H21NO2S |
|---|---|
| Molecular weight | 267.39 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-phenyl-3-sulfanylpropan-2-yl]carbamate |
| InChIKey | PYBYEBRVJRDWPB-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)CS |
Computed by PubChem (NCBI)