CAS 213192-26-8 appears in our catalog under these names: Methyl 2-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate, 95%, TBTC, 2-Amino-6-tert-butyl-4,5,6,7-tetrahydrobenzo[b]-thiophene-3-carboxylic acid methyl ester. Offered by: Combi-blocks, MedChemExpress, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100 mg, 50 mg, 10 mg, 25 mg, 5 mg.
Methyl 2-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (CAS 213192-26-8) is a chemical compound with the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. IUPAC name: methyl 2-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate. InChIKey: BYFPSGIBNPFZOY-UHFFFAOYSA-N.
| Molecular formula | C14H21NO2S |
|---|---|
| Molecular weight | 267.39 g/mol |
| IUPAC name | methyl 2-amino-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| InChIKey | BYFPSGIBNPFZOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2=C(C1)SC(=C2C(=O)OC)N |
Computed by PubChem (NCBI)