cas: 1214-48-8 — see every product listed under this CAS number, including other names
2-Amino-N-(pyridin-3-ylmethyl)benzamide, 99.87% (CAS 1214-48-8) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 500 mg, 250 mg, 1 g, 100 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-46832-5 g |
| cas | 1214-48-8 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 2493.08 Pln | |
| MedChemExpress | 500 mg | 649.42 Pln | |
| MedChemExpress | 250 mg | 454.37 Pln | |
| MedChemExpress | 1 g | 937.34 Pln | |
| MedChemExpress | 100 mg | 310.40 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.87% |
2-amino-N-(pyridin-3-ylmethyl)benzamide (CAS 1214-48-8) is a chemical compound with the molecular formula C13H13N3O and a molecular weight of 227.26 g/mol. IUPAC name: 2-amino-N-(pyridin-3-ylmethyl)benzamide. InChIKey: VQCAHUSKECKWPX-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 2-amino-N-(pyridin-3-ylmethyl)benzamide |
| InChIKey | VQCAHUSKECKWPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NCC2=CN=CC=C2)N |
Computed by PubChem (NCBI)