cas: 1214-48-8 — see every product listed under this CAS number, including other names
2-amino-N-(3-pyridinylmethyl)benzamide hydrochloride, 98%, 98% (CAS 1214-48-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11926N-100mg |
| cas | 1214-48-8 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 554.00 Pln | |
| Chemat | 5g | 1461.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-N-(pyridin-3-ylmethyl)benzamide (CAS 1214-48-8) is a chemical compound with the molecular formula C13H13N3O and a molecular weight of 227.26 g/mol. IUPAC name: 2-amino-N-(pyridin-3-ylmethyl)benzamide. InChIKey: VQCAHUSKECKWPX-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 2-amino-N-(pyridin-3-ylmethyl)benzamide |
| InChIKey | VQCAHUSKECKWPX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NCC2=CN=CC=C2)N |
Computed by PubChem (NCBI)