cas: 70693-59-3 — see every product listed under this CAS number, including other names
2-Amino-N-cyclohexyl-N-methylbenzenesulfonamide, 98%+,RG, 98%+,RG (CAS 70693-59-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114B77-5g |
| cas | 70693-59-3 |
| size | 5g |
| availability | 700g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 136.40 Pln | |
| Chemat | 25g | 342.80 Pln | |
| Chemat | 100g | 808.40 Pln |
| purity | 98%+,RG |
|---|---|
| delivery time | 3 weeks |
2-amino-N-cyclohexyl-N-methylbenzenesulfonamide (CAS 70693-59-3) is a chemical compound with the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. IUPAC name: 2-amino-N-cyclohexyl-N-methylbenzenesulfonamide. InChIKey: IPEHSCPRVOWQFQ-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O2S |
|---|---|
| Molecular weight | 268.38 g/mol |
| IUPAC name | 2-amino-N-cyclohexyl-N-methylbenzenesulfonamide |
| InChIKey | IPEHSCPRVOWQFQ-UHFFFAOYSA-N |
| SMILES | CN(C1CCCCC1)S(=O)(=O)C2=CC=CC=C2N |
Computed by PubChem (NCBI)