CAS 554423-28-8 is the registry number for 4-(3,5-Dimethyl-piperidine-1-sulfonyl)-phenylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
4-(3,5-dimethylpiperidin-1-yl)sulfonylaniline (CAS 554423-28-8) is a chemical compound with the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. IUPAC name: 4-(3,5-dimethylpiperidin-1-yl)sulfonylaniline. InChIKey: CRYNHMDLCOBJQA-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O2S |
|---|---|
| Molecular weight | 268.38 g/mol |
| IUPAC name | 4-(3,5-dimethylpiperidin-1-yl)sulfonylaniline |
| InChIKey | CRYNHMDLCOBJQA-UHFFFAOYSA-N |
| SMILES | CC1CC(CN(C1)S(=O)(=O)C2=CC=C(C=C2)N)C |
Computed by PubChem (NCBI)