CAS 353467-24-0 appears in our catalog under these names: 2-Amino-6-methyl-4,5,6,7-tetrahydro-thieno[2,3-c]pyridine-3-carboxylic acid tert-butyl ester, 95%, 2-Amino-6-methyl-4,5,6,7-tetrahydro-thieno(2,3-c)pyridine-3-carboxylic acid tert-butyl ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g, 250mg.
Tert-butyl 2-amino-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate (CAS 353467-24-0) is a chemical compound with the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. IUPAC name: tert-butyl 2-amino-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate. InChIKey: RVNNJSVXSVSIAJ-UHFFFAOYSA-N.
| Molecular formula | C13H20N2O2S |
|---|---|
| Molecular weight | 268.38 g/mol |
| IUPAC name | tert-butyl 2-amino-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate |
| InChIKey | RVNNJSVXSVSIAJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(SC2=C1CCN(C2)C)N |
Computed by PubChem (NCBI)