CAS 174291-97-5 appears in our catalog under these names: (1S,2S)-(+)-N-P-Tosyl-1,2-cyclohexanediamine, 97%, (1S,2S)–N–p–Tosyl–1,2–cyclohexanediamine, N-((1S,2S)-2-Aminocyclohexyl)-4-methylbenzenesulfonamide 98%, (1S,2S)-N-Tosylcyclohexane-1,2-diamine, 98%, 98%, (1S,2S)-N-p-Tosyl-1,2-cyclohexanediamine, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 1g, 250mg, 100g.
N-[(1S,2S)-2-aminocyclohexyl]-4-methylbenzenesulfonamide (CAS 174291-97-5) is a chemical compound with the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. IUPAC name: N-[(1S,2S)-2-aminocyclohexyl]-4-methylbenzenesulfonamide. InChIKey: VVOFSHARRCJLLA-STQMWFEESA-N.
| Molecular formula | C13H20N2O2S |
|---|---|
| Molecular weight | 268.38 g/mol |
| IUPAC name | N-[(1S,2S)-2-aminocyclohexyl]-4-methylbenzenesulfonamide |
| InChIKey | VVOFSHARRCJLLA-STQMWFEESA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@H]2CCCC[C@@H]2N |
Computed by PubChem (NCBI)