cas: 1365272-16-7 — see every product listed under this CAS number, including other names
2-Amino-N-isopropylbenzenesulfonamide, HCl, 98%, 98% (CAS 1365272-16-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110X2F-250mg |
| cas | 1365272-16-7 |
| size | 250mg |
| availability | 2400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 25g | 443.60 Pln | |
| Chemat | 100g | 1254.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-N-propan-2-ylbenzenesulfonamide;hydrochloride (CAS 1365272-16-7) is a chemical compound with the molecular formula C9H15ClN2O2S and a molecular weight of 250.75 g/mol. IUPAC name: 2-amino-N-propan-2-ylbenzenesulfonamide;hydrochloride. InChIKey: AZJSEFZKFUDKQO-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2O2S |
|---|---|
| Molecular weight | 250.75 g/mol |
| IUPAC name | 2-amino-N-propan-2-ylbenzenesulfonamide;hydrochloride |
| InChIKey | AZJSEFZKFUDKQO-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=CC=CC=C1N.Cl |
Computed by PubChem (NCBI)