cas: 1365272-16-7 — see every product listed under this CAS number, including other names
2-Amino-N-isopropylbenzenesulfonamide, HCl, 98% (CAS 1365272-16-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 25g, 100g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A887614-5g |
| cas | 1365272-16-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 323.89 Pln | |
| AmBeed | 1g | 154.63 Pln | |
| Fluorochem | 25g | 560.24 Pln | |
| Fluorochem | 100g | 1559.89 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-N-propan-2-ylbenzenesulfonamide;hydrochloride (CAS 1365272-16-7) is a chemical compound with the molecular formula C9H15ClN2O2S and a molecular weight of 250.75 g/mol. IUPAC name: 2-amino-N-propan-2-ylbenzenesulfonamide;hydrochloride. InChIKey: AZJSEFZKFUDKQO-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN2O2S |
|---|---|
| Molecular weight | 250.75 g/mol |
| IUPAC name | 2-amino-N-propan-2-ylbenzenesulfonamide;hydrochloride |
| InChIKey | AZJSEFZKFUDKQO-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=CC=CC=C1N.Cl |
Computed by PubChem (NCBI)