cas: 1195995-72-2 — see every product listed under this CAS number, including other names
2-Aminopyridine-4-boronic acid pinacol ester, 95% (CAS 1195995-72-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F221454-250MG |
| cas | 1195995-72-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 2g | 487.35 Pln | |
| Fluorochem | 5g | 909.07 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (CAS 1195995-72-2) is a chemical compound with the molecular formula C11H17BN2O2 and a molecular weight of 220.08 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine. InChIKey: DCYKWKYBNWRLLZ-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O2 |
|---|---|
| Molecular weight | 220.08 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| InChIKey | DCYKWKYBNWRLLZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC=C2)N |
Computed by PubChem (NCBI)