cas: 1434128-52-5 — see every product listed under this CAS number, including other names
2-Aminopyrido(3,4-d)pyrimidin-4(3h)-one, 98+% (CAS 1434128-52-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A715512-5g |
| cas | 1434128-52-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 15166.69 Pln | |
| AmBeed | 100mg | 1358.98 Pln | |
| AmBeed | 10g | 25231.15 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-3H-pyrido[3,4-d]pyrimidin-4-one (CAS 1434128-52-5) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. IUPAC name: 2-amino-3H-pyrido[3,4-d]pyrimidin-4-one. InChIKey: AUABAUOBYXWSKR-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 2-amino-3H-pyrido[3,4-d]pyrimidin-4-one |
| InChIKey | AUABAUOBYXWSKR-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C(=O)NC(=N2)N |
Computed by PubChem (NCBI)