CAS 59282-83-6 appears in our catalog under these names: 5-Pyridin-3-yl-2h-[1,2,4]triazol-3-ol, 95%, 5-Pyridin-3-yl-4h-[1,2,4]triazol-3-ol, 95%, 5-Pyridin-3-yl-2,4-dihydro-[1,2,4]triazol-3-one, 95%, 3-(Pyridin-3-yl)-1H-1,2,4-triazol-5(4H)-one, 95+%, 5-Pyridin-3-yl-2H-(1,2,4)triazol-3-ol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 5g, 250mg, 0,5g.
3-pyridin-3-yl-1,4-dihydro-1,2,4-triazol-5-one (CAS 59282-83-6) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. IUPAC name: 3-pyridin-3-yl-1,4-dihydro-1,2,4-triazol-5-one. InChIKey: JVOIBEVPZKHMKO-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 3-pyridin-3-yl-1,4-dihydro-1,2,4-triazol-5-one |
| InChIKey | JVOIBEVPZKHMKO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NNC(=O)N2 |
Computed by PubChem (NCBI)