CAS 5711-73-9 appears in our catalog under these names: 5-(Pyridin-3-yl)-1,3,4-oxadiazol-2-amine, 98%, 5-Pyridin-3-yl-1,3,4-oxadiazol-2-ylamine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg, 500mg, 10g.
5-pyridin-3-yl-1,3,4-oxadiazol-2-amine (CAS 5711-73-9) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. IUPAC name: 5-pyridin-3-yl-1,3,4-oxadiazol-2-amine. InChIKey: JMAJFOJPCCULLE-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 5-pyridin-3-yl-1,3,4-oxadiazol-2-amine |
| InChIKey | JMAJFOJPCCULLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NN=C(O2)N |
Computed by PubChem (NCBI)