CAS 530-62-1 appears in our catalog under these names: 1,1'-Carbonyldiimidazole, 95%, 1,1'-Carbonyldiimidazole, 1,1'-Carbonyldiimidazole (>90%), >95% (HPLC), N,N'-Carbonyldiimidazole/ 98+%, 1,1'-Carbonyldiimidazole, 97% . Offered by: Combi-blocks, Chemat Brand, TRC, Chemat, Thermo Scientific (Alfa Aesar). Available pack sizes: 100g, 25g, 500g, 1kg, 5g, on request, 10g, 50g.
Di(imidazol-1-yl)methanone (CAS 530-62-1) is a chemical compound with the molecular formula C7H6N4O and a molecular weight of 162.15 g/mol. IUPAC name: di(imidazol-1-yl)methanone. InChIKey: PFKFTWBEEFSNDU-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | di(imidazol-1-yl)methanone |
| InChIKey | PFKFTWBEEFSNDU-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)C(=O)N2C=CN=C2 |
Computed by PubChem (NCBI)