cas: 42712-64-1 — see every product listed under this CAS number, including other names
2-Aminoquinolin-4-ol, 95%, 95% (CAS 42712-64-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GK5-100mg |
| cas | 42712-64-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 707.60 Pln | |
| Chemat | 25g | 2709.20 Pln | |
| Chemat | 10g | 1235.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-amino-1H-quinolin-4-one (CAS 42712-64-1) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 2-amino-1H-quinolin-4-one. InChIKey: LWGUCIXHBVVATR-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 2-amino-1H-quinolin-4-one |
| InChIKey | LWGUCIXHBVVATR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(N2)N |
Computed by PubChem (NCBI)