CAS 89196-95-2 appears in our catalog under these names: 2–BFI hydrochloride, 2-BFI hydrochloride/ 100%, RX 801077 HCl 99%, RX 801077 (hydrochloride), 99%, 99%, RX 801077 (hydrochloride), 99.82%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 200mg, 250mg, 10mM/1mL.
2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole;hydrochloride (CAS 89196-95-2) is a chemical compound with the molecular formula C11H11ClN2O and a molecular weight of 222.67 g/mol. IUPAC name: 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole;hydrochloride. InChIKey: RFNFFVDVGWOSNZ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 2-(1-benzofuran-2-yl)-4,5-dihydro-1H-imidazole;hydrochloride |
| InChIKey | RFNFFVDVGWOSNZ-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)C2=CC3=CC=CC=C3O2.Cl |
Computed by PubChem (NCBI)