cas: 1261667-41-7 — see every product listed under this CAS number, including other names
2-BROMO-3,5-BIS(TRIFLUOROMETHYL)ANISOLE, 97% (CAS 1261667-41-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306921-1G |
| cas | 1261667-41-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 627.92 Pln | |
| Fluorochem | 5g | 1913.93 Pln | |
| Fluorochem | 25g | 6407.14 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-1-methoxy-3,5-bis(trifluoromethyl)benzene (CAS 1261667-41-7) is a chemical compound with the molecular formula C9H5BrF6O and a molecular weight of 323.03 g/mol. IUPAC name: 2-bromo-1-methoxy-3,5-bis(trifluoromethyl)benzene. InChIKey: YXRADAZCEPPFKP-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF6O |
|---|---|
| Molecular weight | 323.03 g/mol |
| IUPAC name | 2-bromo-1-methoxy-3,5-bis(trifluoromethyl)benzene |
| InChIKey | YXRADAZCEPPFKP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1Br)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)