cas: 1261667-41-7 — see every product listed under this CAS number, including other names
2-Bromo-1-methoxy-3,5-bis(trifluoromethyl)benzene, 97%, 97% (CAS 1261667-41-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111RXN-250mg |
| cas | 1261667-41-7 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 395.60 Pln | |
| Chemat | 5g | 1173.20 Pln | |
| Chemat | 10g | 1922.00 Pln | |
| Chemat | 25g | 3885.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-1-methoxy-3,5-bis(trifluoromethyl)benzene (CAS 1261667-41-7) is a chemical compound with the molecular formula C9H5BrF6O and a molecular weight of 323.03 g/mol. IUPAC name: 2-bromo-1-methoxy-3,5-bis(trifluoromethyl)benzene. InChIKey: YXRADAZCEPPFKP-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF6O |
|---|---|
| Molecular weight | 323.03 g/mol |
| IUPAC name | 2-bromo-1-methoxy-3,5-bis(trifluoromethyl)benzene |
| InChIKey | YXRADAZCEPPFKP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1Br)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)