cas: 1150617-58-5 — see every product listed under this CAS number, including other names
2-BROMO-7-CHLORO-5H-PYRROLO[2,3-B]PYRAZINE, 97% (CAS 1150617-58-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F858703-100MG |
| cas | 1150617-58-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 794.53 Pln | |
| Fluorochem | 250mg | 1216.26 Pln | |
| Fluorochem | 1g | 3580.01 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-7-chloro-5H-pyrrolo[2,3-b]pyrazine (CAS 1150617-58-5) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 2-bromo-7-chloro-5H-pyrrolo[2,3-b]pyrazine. InChIKey: VKBKVPMFSIOUCS-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 2-bromo-7-chloro-5H-pyrrolo[2,3-b]pyrazine |
| InChIKey | VKBKVPMFSIOUCS-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC(=CN=C2N1)Br)Cl |
Computed by PubChem (NCBI)