cas: 1150617-58-5 — see every product listed under this CAS number, including other names
2-Bromo-7-chloro-5H-pyrrolo[2,3-b]pyrazine, 97%, 97% (CAS 1150617-58-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111FTJ-100mg |
| cas | 1150617-58-5 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 630.80 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2795.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-7-chloro-5H-pyrrolo[2,3-b]pyrazine (CAS 1150617-58-5) is a chemical compound with the molecular formula C6H3BrClN3 and a molecular weight of 232.46 g/mol. IUPAC name: 2-bromo-7-chloro-5H-pyrrolo[2,3-b]pyrazine. InChIKey: VKBKVPMFSIOUCS-UHFFFAOYSA-N.
| Molecular formula | C6H3BrClN3 |
|---|---|
| Molecular weight | 232.46 g/mol |
| IUPAC name | 2-bromo-7-chloro-5H-pyrrolo[2,3-b]pyrazine |
| InChIKey | VKBKVPMFSIOUCS-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC(=CN=C2N1)Br)Cl |
Computed by PubChem (NCBI)