cas: 154456-97-0 — see every product listed under this CAS number, including other names
2-Benzyl 1-(tert-butyl) (S)-4-oxopyrrolidine-1,2-dicarboxylate, 98% (CAS 154456-97-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F613962-100MG |
| cas | 154456-97-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 601.89 Pln | |
| Fluorochem | 1g | 1658.81 Pln | |
| Fluorochem | 5g | 5376.25 Pln | |
| Fluorochem | 10g | 7370.34 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-O-benzyl 1-O-tert-butyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate (CAS 154456-97-0) is a chemical compound with the molecular formula C17H21NO5 and a molecular weight of 319.4 g/mol. IUPAC name: 2-O-benzyl 1-O-tert-butyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate. InChIKey: JBOGNSRGCLEJEM-AWEZNQCLSA-N.
| Molecular formula | C17H21NO5 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 2-O-benzyl 1-O-tert-butyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | JBOGNSRGCLEJEM-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)C[C@H]1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)