cas: 3740-82-7 — see every product listed under this CAS number, including other names
2-Benzyl-4,6-dichloropyrimidine, 95%, 95% (CAS 3740-82-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYPA-100mg |
| cas | 3740-82-7 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1370.00 Pln | |
| Chemat | 250mg | 2680.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-benzyl-4,6-dichloropyrimidine (CAS 3740-82-7) is a chemical compound with the molecular formula C11H8Cl2N2 and a molecular weight of 239.10 g/mol. IUPAC name: 2-benzyl-4,6-dichloropyrimidine. InChIKey: ACEVCJQVGFNGAU-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | 2-benzyl-4,6-dichloropyrimidine |
| InChIKey | ACEVCJQVGFNGAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)