CAS 796095-89-1 is the registry number for 4-Benzyl-2,6-dichloropyrimidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
4-benzyl-2,6-dichloropyrimidine (CAS 796095-89-1) is a chemical compound with the molecular formula C11H8Cl2N2 and a molecular weight of 239.10 g/mol. IUPAC name: 4-benzyl-2,6-dichloropyrimidine. InChIKey: LIGZTXSHXRNYKM-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | 4-benzyl-2,6-dichloropyrimidine |
| InChIKey | LIGZTXSHXRNYKM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)