Products 796095-89-1

CAS 796095-89-1 is the registry number for 4-Benzyl-2,6-dichloropyrimidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

4-benzyl-2,6-dichloropyrimidine (CAS 796095-89-1) is a chemical compound with the molecular formula C11H8Cl2N2 and a molecular weight of 239.10 g/mol. IUPAC name: 4-benzyl-2,6-dichloropyrimidine. InChIKey: LIGZTXSHXRNYKM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H8Cl2N2
Molecular weight239.10 g/mol
IUPAC name4-benzyl-2,6-dichloropyrimidine
InChIKeyLIGZTXSHXRNYKM-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC2=CC(=NC(=N2)Cl)Cl

Computed by PubChem (NCBI)