CAS 1073114-78-9 is the registry number for 5-(2,4-Dichlorophenyl)pyridin-2-amine, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
5-(2,4-dichlorophenyl)pyridin-2-amine (CAS 1073114-78-9) is a chemical compound with the molecular formula C11H8Cl2N2 and a molecular weight of 239.10 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)pyridin-2-amine. InChIKey: ZNFTYJQTJXHFNC-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)pyridin-2-amine |
| InChIKey | ZNFTYJQTJXHFNC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=CN=C(C=C2)N |
Computed by PubChem (NCBI)