CAS 1221971-23-8 is the registry number for 6-(3,4-Dichlorophenyl)pyridin-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-(3,4-dichlorophenyl)pyridin-3-amine (CAS 1221971-23-8) is a chemical compound with the molecular formula C11H8Cl2N2 and a molecular weight of 239.10 g/mol. IUPAC name: 6-(3,4-dichlorophenyl)pyridin-3-amine. InChIKey: XHOXRFHGKYAXNK-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2N2 |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | 6-(3,4-dichlorophenyl)pyridin-3-amine |
| InChIKey | XHOXRFHGKYAXNK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=NC=C(C=C2)N)Cl)Cl |
Computed by PubChem (NCBI)